Enaminomycin A | CAS No. | 68330-49-4 |
| Molecular Weight | 183.12 |
| Formula | C7H5NO5 |
| SMILES | O=C1[C@]2([H])[C@@](C(C(N)=C1C(O)=O)=O)([H])O2 |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22859 | Massarigenin C | Inquiry |
|
| MDP-22852 | Avellanin B | Inquiry |
|
| MDP-11354 | Cyclopiazonic Acid | Inquiry |
|
| MDP-24297 | Phenylpyropene B | Inquiry |
|
| MDP-23534 | Albiducin A | Inquiry |
|
| MDP-23782 | Crocacin C | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
