Enniatin F | CAS No. | 144446-20-8 |
| Molecular Weight | 681.90 |
| Formula | C36H63N3O9 |
| SMILES | O=C1O[C@@H](C(N(C)[C@H](C(O[C@@H](C(N(C)[C@H](C(O[C@@H](C(N(C)[C@H]1CC(C)C)=O)C(C)C)=O)[C@@H](C)CC)=O)C(C)C)=O)[C@H](C)CC)=O)C(C)C |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23454 | Alliacol B | Inquiry |
|
| MDP-23021 | D-Tagatose (Standard) | Inquiry |
|
| MDP-23578 | 2-Hydroxyaclacinomycin B | Inquiry |
|
| MDP-23883 | Parvodicin A | Inquiry |
|
| MDP-23881 | Neoviridogrisein Ⅰ | Inquiry |
|
| MDP-12123 | Staphyloferrin A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
