Epieuphoscopin B | CAS | 126372-45-0 |
| Molecular Weight | 582.68 |
| Formula | C33H42O9 |
| SMILES | C/C([C@@H](C1)OC(C)=O)=C\[C@]([C@@H](OC(C2=CC=CC=C2)=O)[C@H](C)C3)([H])[C@@]3(OC(C)=O)[C@H](OC(C)=O)[C@@H](C)/C=C\C(C)(C)C1=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14723 | 5,7-Dihydroxy-4-methylcoumarin | Inquiry |
|
| PDP-19817 | Scutellarin (Standard) | Inquiry |
|
| PDP-15913 | Cycloartenyl Ferulate | Inquiry |
|
| PDP-18659 | Rabdosin C | Inquiry |
|
| PDP-16609 | Isocolumbin | Inquiry |
|
| PDP-15083 | N-Nornuciferine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
