Epimedin K | Synonyms | Korepimedoside B |
| CAS | 174286-13-6 |
| Molecular Weight | 964.91 |
| Formula | C45H56O23 |
| SMILES | C/C(C)=C\CC(C(O[C@@H]([C@@H]([C@H]1O)O)O[C@@H]([C@H]1O)CO)=C2)=C(OC(C(C=C3)=CC=C3OC)=C4O[C@H](O[C@H]5C)[C@@H]([C@@H]([C@H]5OC(C)=O)O[C@H](O[C@@H]6COC(C)=O)[C@@H]([C@H]([C@@H]6O)O)OC(C)=O)O)C(C4=O)=C2O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16694 | Acetylthevetin A | Inquiry |
|
| PDP-15575 | (S,S)-Pisatin | Inquiry |
|
| PDP-16288 | Docosane | Inquiry |
|
| PDP-13399 | Cardamonin | Inquiry |
|
| PDP-14358 | Atranorin | Inquiry |
|
| PDP-18918 | Triptoquinone A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
