Epimedokoreanin B | Appearance | Solid |
| CAS | 161068-53-7 |
| Molecular Weight | 422.47 |
| Formula | C25H26O6 |
| Color | Light yellow to yellow |
| SMILES | O=C1C=C(C2=CC(C/C=C(C)\C)=C(O)C(O)=C2)OC3=C(C/C=C(C)\C)C(O)=CC(O)=C13 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13507 | (20S)-Protopanaxatriol | Inquiry |
|
| PDP-13410 | Butein | Inquiry |
|
| PDP-17385 | Chloranthalactone E | Inquiry |
|
| PDP-14690 | Karacoline | Inquiry |
|
| PDP-16089 | Chloramultilide B | Inquiry |
|
| PDP-17038 | Sophoranol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
