Epoxymicheliolide | Synonyms | 1β,10β-Epoxymicheliolide |
| Appearance | Solid |
| CAS | 1343403-10-0 |
| Purity | 99.84% |
| Molecular Weight | 264.32 |
| Formula | C15H20O4 |
| Color | White to off-white |
| SMILES | C[C@]1(CC[C@](C2=C)([H])[C@@](OC2=O)([H])[C@@]3([H])[C@](C)(O)CC4)[C@]34O1 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, sealed storage, away from moisture and light In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture and light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17219 | (-)-Cleistenolide | Inquiry |
|
| PDP-14423 | Convallatoxin | Inquiry |
|
| PDP-18108 | Periglaucine B | Inquiry |
|
| PDP-13985 | Ajmaline | Inquiry |
|
| PDP-16281 | Longistyline A | Inquiry |
|
| PDP-19247 | Cubebin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
