Ergosterol (Standard) | CAS No. | 57-87-4 |
| Synonyms | Ergosterin(Standard); Provitamin D(Standard); Provitamin D2 (Standard) |
| Molecular Weight | 396.65 |
| Formula | C28H44O |
| SMILES | C[C@H](C(C)C)/C=C/[C@@H](C)[C@H]1CC[C@@]2([H])C3=CC=C4C[C@@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C |
| Intended Use | For research use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23833 | Griseusin B | Inquiry |
|
| MDP-11370 | Purine | Inquiry |
|
| MDP-23415 | Amythiamicin D | Inquiry |
|
| MDP-24270 | Chloronectrin | Inquiry |
|
| MDP-23438 | Isariin A | Inquiry |
|
| MDP-22208 | Cycloartenol (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
