Eriodictyol-7-O-glucoside | Synonyms | Eriodictyol 7-O-β-D-glucoside |
| Appearance | Solid |
| CAS | 38965-51-4 |
| Purity | 99.82% |
| Molecular Weight | 450.39 |
| Formula | C21H22O11 |
| Color | Off-white to light yellow |
| SMILES | O=C1C2=C(O)C=C(O[C@@H]3O[C@@H]([C@H]([C@@H]([C@H]3O)O)O)CO)C=C2O[C@H](C4=CC(O)=C(C=C4)O)C1 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14790 | Tetrahydropiperine | Inquiry |
|
| PDP-18977 | Isomorellic Acid | Inquiry |
|
| PDP-14741 | Dulcoside A | Inquiry |
|
| PDP-17002 | Pterisolic Acid B | Inquiry |
|
| PDP-15446 | Isoscutellarein | Inquiry |
|
| PDP-16430 | Anhydrosecoisolariciresinol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
