Esculentoside B | Synonyms | Phytolaccoside B |
| CAS | 60820-94-2 |
| Molecular Weight | 664.82 |
| Formula | C36H56O11 |
| SMILES | C[C@@]12C([C@@]3([H])[C@](C(O)=O)(CC[C@@](C(OC)=O)(C)C3)CC2)=CC[C@@]4([H])[C@]1(CC[C@]5([H])[C@@]4(C[C@H](O)[C@H](O[C@@]6([H])[C@@H]([C@H]([C@H](O)CO6)O)O)[C@@]5(C)CO)C)C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16211 | Rhombifoline | Inquiry |
|
| PDP-14456 | Myristicin | Inquiry |
|
| PDP-13556 | Silychristin | Inquiry |
|
| PDP-17571 | 1,1'-Disinomenine | Inquiry |
|
| PDP-15628 | Ginsenoside Rg4 | Inquiry |
|
| PDP-17305 | 1-Oxomiltirone | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
