Espicufolin | CAS No. | 182232-96-8 |
| Molecular Weight | 378.37 |
| Formula | C22H18O6 |
| SMILES | O=C1C2=C(C(C3=CC=CC(O)=C31)=O)C=C(CO)C4=C2OC([C@H](C)CC)=CC4=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-12025 | HMBPP Lithium | Inquiry |
|
| MDP-12614 | Saccharothrixin F | Inquiry |
|
| MDP-24237 | Cephaibol A | Inquiry |
|
| MDP-24292 | Phosmidosine B | Inquiry |
|
| MDP-24020 | Panclicin C | Inquiry |
|
| MDP-24268 | Dioxamycin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
