Eupalinolide K | Appearance | Solid |
| CAS | 108657-10-9 |
| Purity | 99.20% |
| Molecular Weight | 362.42 |
| Formula | C20H26O6 |
| Color | Off-white to light yellow |
| SMILES | O=C(/C(C)=C/CO)O[C@H](C/C(C)=C\C[C@H](O)/C(C)=C\1)[C@](C2=C)([H])[C@]1([H])OC2=O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14903 | Quassin | Inquiry |
|
| PDP-19113 | (+)-N-Formylnorglaucine | Inquiry |
|
| PDP-18919 | 3'-O-Methylmurraol | Inquiry |
|
| PDP-16098 | Effusanin A | Inquiry |
|
| PDP-15897 | Avenanthramide C | Inquiry |
|
| PDP-14135 | 5-O-Methylembelin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
