Eupatoriochromene | CAS | 19013-03-7 |
| Molecular Weight | 218.25 |
| Formula | C13H14O3 |
| SMILES | CC(C1=C(O)C=C2C(C=CC(C)(C)O2)=C1)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14509 | Gossypin | Inquiry |
|
| PDP-15822 | 8-Oxocoptisine | Inquiry |
|
| PDP-13379 | Polyphyllin I | Inquiry |
|
| PDP-17393 | Euphebracteolatin B | Inquiry |
|
| PDP-15863 | Sagittatoside B | Inquiry |
|
| PDP-19144 | Jacobine N-oxide | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
