Evoxine | Synonyms | Haplophytin B; Haplophytine B |
| CAS | 522-11-2 |
| Molecular Weight | 347.36 |
| Formula | C18H21NO6 |
| SMILES | COC1=C2C(C(OC)=C3C(OC=C3)=N2)=CC=C1OC[C@@H](O)C(C)(O)C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15028 | Graveobioside A | Inquiry |
|
| PDP-16918 | Xinjiachalcone A | Inquiry |
|
| PDP-15639 | Licorice Glycoside C2 | Inquiry |
|
| PDP-14600 | Kuwanon H | Inquiry |
|
| PDP-18508 | Mulberrofuran Q | Inquiry |
|
| PDP-14810 | Moronic Acid | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
