Fibrostatin C | CAS No. | 91776-47-5 |
| Synonyms | P-23924C |
| Molecular Weight | 409.41 |
| Formula | C18H19NO8S |
| SMILES | O=C([C@@H](NC(C)=O)CSCC(C(O)=C1C2=O)=C(C=C1C(C(OC)=C2)=O)OC)O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-21953 | Diacetonamine | Inquiry |
|
| MDP-11657 | L-Glutathione Reduced (Standard) | Inquiry |
|
| MDP-11402 | (-)-Fucose | Inquiry |
|
| MDP-23954 | Megovalicin B | Inquiry |
|
| MDP-22522 | Arborcandin D | Inquiry |
|
| MDP-11975 | Oct-1-en-3-ol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
