Filicenol B | CAS | 145103-37-3 |
| Molecular Weight | 426.72 |
| Formula | C30H50O |
| SMILES | OC[C@]12[C@@](CC[C@]3([C@@]2([H])CCC=C3C)C)([H])[C@@]4([C@@](CC1)([C@@]5([H])[C@](CC4)([C@H](CC5)C(C)C)C)C)C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18991 | Diversoside | Inquiry |
|
| PDP-18760 | 3α-Hydroxytanshinone IIA | Inquiry |
|
| PDP-13403 | Chrysophanol | Inquiry |
|
| PDP-20102 | Moschamine | Inquiry |
|
| PDP-19798 | (+)-Usnic Acid (Standard) | Inquiry |
|
| PDP-13912 | Harmane | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
