Frenolicin B | CAS No. | 68930-68-7 |
| Molecular Weight | 328.32 |
| Formula | C18H16O6 |
| SMILES | O=C1C2=C(C(C3=C(O)C=CC=C31)=O)[C@H](O[C@@]4([H])[C@]2([H])OC(C4)=O)CCC |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11386 | Tetrahydrocurcumin | Inquiry |
|
| MDP-23564 | Frenolicin | Inquiry |
|
| MDP-23747 | Glysperin B | Inquiry |
|
| MDP-24071 | Naphthyridinomycin | Inquiry |
|
| MDP-23011 | Tetromycin C1 | Inquiry |
|
| MDP-23298 | Gentamicin C1a (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
