Fujianmycin A | CAS No. | 96695-57-7 |
| Molecular Weight | 322.31 |
| Formula | C19H14O5 |
| SMILES | O=C1C2=C(C(C3=C(O)C=CC=C31)=O)C=CC([C@H]([C@@H](C4)C)O)=C2C4=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22930 | Antibiotic WB | Inquiry |
|
| MDP-23118 | 2-C-Methyl-D-erythritol 4-phosphate | Inquiry |
|
| MDP-11817 | 3-Hydroxybenzaldehyde | Inquiry |
|
| MDP-21881 | Integracin B | Inquiry |
|
| MDP-11186 | Hippuric Acid | Inquiry |
|
| MDP-24108 | Istamycin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.