Fujianmycin B | CAS No. | 130548-09-3 |
| Synonyms | SNA-8073A; Rubiginone A2 |
| Molecular Weight | 336.34 |
| Formula | C20H16O5 |
| SMILES | O=C1C[C@@H](C)[C@H](O)C(C1=C2C3=O)=CC=C2C(C4=C3C=CC=C4OC)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-12242 | L-Theanine (Standard) | Inquiry |
|
| MDP-12525 | Kijanimicin | Inquiry |
|
| MDP-22178 | T-MAS | Inquiry |
|
| MDP-22401 | Gaxilose | Inquiry |
|
| MDP-12369 | Sisomicin (sulfate) (Standard) | Inquiry |
|
| MDP-24097 | Ganoderic Acid U | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
