Fumagillin | CAS No. | 23110-15-8 |
| Purity | ≥99.0% |
| Synonyms | Amebacilin; NSC9168 |
| Molecular Weight | 458.54 |
| Formula | C26H34O7 |
| Appearance | Solid |
| Color | White to light yellow |
| SMILES | C[C@]1([C@@H](C/C=C(C)/C)O1)[C@]([C@@H]2OC)([H])[C@]3(CC[C@H]2OC(/C=C/C=C/C=C/C=C/C(O)=O)=O)CO3 |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
4°C, stored under nitrogen In solvent: -80°C, 6 months; -20°C, 1 month (stored under nitrogen) |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-12347 | L-Methionine (Standard) | Inquiry |
|
| MDP-22374 | Xenoclauxin | Inquiry |
|
| MDP-11077 | Pronase E (Activity ≥ 4000 U/mg) | Inquiry |
|
| MDP-23862 | Gentamicin A | Inquiry |
|
| MDP-22032 | 3,5-Diprenyl-4-hydroxybenzaldehyde | Inquiry |
|
| MDP-23444 | Andrastin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.