Fusicoccin H | CAS No. | 50906-51-9 |
| Molecular Weight | 482.61 |
| Formula | C26H42O8 |
| SMILES | C[C@@]1(/C=C2[C@](CC[C@@H]\2CO)([H])[C@H]([C@H]3O)C)C([C@H]3O[C@H]4O[C@@H]([C@H]([C@@H]([C@H]4O)O)O)CO)=C(C(C)C)CC1 |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22310 | Astringin (Standard) | Inquiry |
|
| MDP-23825 | Katanosin A | Inquiry |
|
| MDP-22533 | Argyrin B | Inquiry |
|
| MDP-11122 | SDMA | Inquiry |
|
| MDP-23275 | Itraconazole (Standard) | Inquiry |
|
| MDP-24031 | 2-Hydroxygentamicin C2 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
