Galanthamine (hydrobromide) (Standard) | Synonyms | Galantamine (hydrobromide) (Standard) |
| CAS | 1953-04-4 |
| Molecular Weight | 368.27 |
| Formula | C17H22BrNO3 |
| SMILES | O[C@@H]1C[C@@H]2OC3=C4C(CN(C)CC[C@]42C=C1)=CC=C3OC.Br |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14032 | Rebaudioside D | Inquiry |
|
| PDP-18991 | Diversoside | Inquiry |
|
| PDP-15000 | (+)-Glaucarubinone | Inquiry |
|
| PDP-19875 | 3'-Hydroxypuerarin (Standard) | Inquiry |
|
| PDP-20504 | 8-Gingerol (Standard) | Inquiry |
|
| PDP-14593 | Ganoderic Acid B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
