Galloylalbiflorin | Synonyms | 6'-O-Galloylalbiflorin |
| Appearance | Solid |
| CAS | 929042-36-4 |
| Molecular Weight | 632.57 |
| Formula | C30H32O15 |
| Color | Off-white to light yellow |
| SMILES | O=C(C1=CC=CC=C1)OC[C@]2(C3=O)[C@@]([C@@](O3)(C4)C)(C[C@H]2[C@@H]4O)O[C@@H]([C@@H]([C@H]5O)O)O[C@@H]([C@H]5O)COC(C(C=C6O)=CC(O)=C6O)=O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, sealed storage, away from moisture In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18176 | Mesuol | Inquiry |
|
| PDP-16470 | Cucurbitacin B (Standard) | Inquiry |
|
| PDP-14412 | Hederacolchiside A1 | Inquiry |
|
| PDP-20121 | Ricinine (Standard) | Inquiry |
|
| PDP-15872 | 1-Nonadecanol | Inquiry |
|
| PDP-16077 | N-Benzyllinolenamide | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
