Garcinone B | CAS | 76996-28-6 |
| Molecular Weight | 394.42 |
| Formula | C23H22O6 |
| SMILES | OC(C(C/C=C(C)/C)=C1O)=CC2=C1C(C3=C4C(OC(C)(C)C=C4)=C(O)C=C3O2)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19838 | Hinokinin (Standard) | Inquiry |
|
| PDP-16952 | Sauristolactam | Inquiry |
|
| PDP-13945 | 10-Deacetylbaccatin III | Inquiry |
|
| PDP-19305 | Gentiside B | Inquiry |
|
| PDP-15204 | 7-Hydroxyaristolochic Acid A | Inquiry |
|
| PDP-16811 | Quinine Hemisulfate | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
