Geissoschizoline | Synonyms | (+)-Geissoschizoline |
| CAS | 18397-07-4 |
| Molecular Weight | 298.42 |
| Formula | C19H26N2O |
| SMILES | OC[C@@H]1[C@@]2([H])[C@]3(C4=CC=CC=C4N2)[C@@]5([H])N(C[C@H]([C@]1([H])C5)CC)CC3 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17461 | 4-O-Methyldebenzoylpaeoniflorin | Inquiry |
|
| PDP-19111 | Phlorigidoside C | Inquiry |
|
| PDP-16289 | Isoengeletin | Inquiry |
|
| PDP-19824 | Chikusetsusaponin Iva (Standard) | Inquiry |
|
| PDP-20028 | Tenuifoliose H | Inquiry |
|
| PDP-13087 | Ponceau 4R Carmine Colorant | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.