Gelsevirine | Appearance | Solid |
| CAS | 38990-03-3 |
| Purity | 98.80% |
| Molecular Weight | 352.43 |
| Formula | C21H24N2O3 |
| Color | Off-white to light yellow |
| SMILES | O=C1[C@]([C@H](OC2)C[C@@H]3[C@@]2([H])[C@@]4([H])N5C)(C6=CC=CC=C6N1OC)[C@]4([H])[C@]3(C5)C=C |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17804 | Neohelmanthicin A | Inquiry |
|
| PDP-16084 | Ophiopogonin D' | Inquiry |
|
| PDP-13748 | Lobetyolin | Inquiry |
|
| PDP-18618 | 5-MethoxyPinocembroside | Inquiry |
|
| PDP-20317 | Emodin (Standard) | Inquiry |
|
| PDP-19477 | Paeonicluside | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
