Genistin | Synonyms | Genistine; Genistoside; Genistein 7-O-β-D-glucopyranoside |
| Appearance | Solid |
| CAS | 529-59-9 |
| Purity | 98.05% |
| Molecular Weight | 432.38 |
| Formula | C21H20O10 |
| Color | White to off-white |
| SMILES | O=C(C(C1=CC=C(O)C=C1)=COC2=CC(O[C@@H]([C@@H]([C@@H](O)[C@@H]3O)O)O[C@@H]3CO)=C4)C2=C4O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 2 years; -20°C 1 year |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18869 | Coreopsin | Inquiry |
|
| PDP-16693 | Entadamide A | Inquiry |
|
| PDP-19305 | Gentiside B | Inquiry |
|
| PDP-16761 | Hypericin (Standard) | Inquiry |
|
| PDP-16896 | Physcion-8-O-(6'-O-malonyl)-glucoside | Inquiry |
|
| PDP-17473 | 1-Methoxymethyl-β-carboline | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
