Gibbestatin B | CAS No. | 89687-34-3 |
| Molecular Weight | 386.44 |
| Formula | C22H26O6 |
| SMILES | CC(O1)C1/C=C(C)/C([C@H]([C@H](C)OC)/C=C/C=C/C2=C(C(O)=CC=C2)C(O)=O)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-12492 | FR198248 | Inquiry |
|
| MDP-24050 | Laccaridione B | Inquiry |
|
| MDP-22587 | Purine (Standard) | Inquiry |
|
| MDP-24155 | Chrolactomycin | Inquiry |
|
| MDP-12756 | Ganoderenic Acid B | Inquiry |
|
| MDP-22995 | Lachnumon | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
