Gigantol | Appearance | Oil |
| CAS | 83088-28-2 |
| Purity | 99.79% |
| Molecular Weight | 274.31 |
| Formula | C16H18O4 |
| Color | Colorless to light yellow |
| SMILES | OC1=CC(CCC2=CC=C(C(OC)=C2)O)=CC(OC)=C1 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Pure form -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13805 | β-Boswellic Acid | Inquiry |
|
| PDP-18166 | Methyl Pseudolarate B | Inquiry |
|
| PDP-19807 | Gracillin (Standard) | Inquiry |
|
| PDP-14165 | Nicotiflorin | Inquiry |
|
| PDP-13173 | Bindarit | Inquiry |
|
| PDP-18971 | Umckalin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
