Gilvocarcin E | CAS No. | 80937-34-4 |
| Molecular Weight | 496.51 |
| Formula | C27H28O9 |
| SMILES | COC1=C2C(C([C@H]3O[C@@]([C@@H]([C@H]3O)O)([H])[C@H](O)C)=CC=C2O)=C4C(C5=C(OC)C=C(CC)C=C5C(O4)=O)=C1 |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-24130 | Glomosporin | Inquiry |
|
| MDP-11929 | N-Acetyl-R-leucine | Inquiry |
|
| MDP-24062 | Macquarimicin B | Inquiry |
|
| MDP-11675 | D-Arabitol | Inquiry |
|
| MDP-23392 | Thiocillin | Inquiry |
|
| MDP-24347 | Oleficin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
