Ginsenoside Rh1 | Synonyms | Prosapogenin A2; Sanchinoside B2; Sanchinoside Rh1 |
| Appearance | Solid |
| CAS | 63223-86-9 |
| Purity | ≥98.0% |
| Molecular Weight | 638.87 |
| Formula | C36H62O9 |
| Color | White to off-white |
| SMILES | C[C@@]([C@@]12C)(C[C@H](O[C@]([C@@H]([C@@H](O)[C@@H]3O)O)([H])O[C@@H]3CO)[C@@]4([H])C5(C)C)[C@@](C[C@@H](O)[C@]1([H])[C@]([C@@](C)(O)CC/C=C(C)/C)([H])CC2)([H])[C@]4(CC[C@@H]5O)C |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 2 years; -20°C 1 year |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14450 | α-L-Rhamnose Monohydrate | Inquiry |
|
| PDP-17394 | 8-epi-Chlorajapolide F | Inquiry |
|
| PDP-14803 | Murrayafoline A | Inquiry |
|
| PDP-19305 | Gentiside B | Inquiry |
|
| PDP-20475 | Diacerein (Standard) | Inquiry |
|
| PDP-13480 | Taraxasterol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
