Glaucin B | Synonyms | 6β-Acetoxy-5-epilimonin |
| CAS | 115458-73-6 |
| Molecular Weight | 528.55 |
| Formula | C28H32O10 |
| SMILES | C[C@]12[C@]34[C@](C(O[C@@H](C5=COC=C5)[C@@]4(CC[C@]1([H])[C@]67[C@](C(C)(O[C@@]6([H])CC(OC7)=O)C)([H])[C@@H](C2=O)OC(C)=O)C)=O)([H])O3 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18997 | 15-Hydroxypinusolidic Acid | Inquiry |
|
| PDP-14588 | Mirificin | Inquiry |
|
| PDP-18210 | Liriodendrin | Inquiry |
|
| PDP-15233 | (±)-Taxifolin | Inquiry |
|
| PDP-14360 | Oxyberberine | Inquiry |
|
| PDP-18144 | Naringenin-4',7-diacetate | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
