Glidobactin G | CAS No. | 119259-71-1 |
| Molecular Weight | 536.66 |
| Formula | C27H44N4O7 |
| SMILES | CCCCCCC/C=C/C=C/C(N[C@H](C(N[C@@H]1C(N[C@@H](CO)/C=C/C(NCC[C@H](O)C1)=O)=O)=O)[C@H](O)C)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-24238 | Cephaibol B | Inquiry |
|
| MDP-22485 | 7-Methylguanine (Standard) | Inquiry |
|
| MDP-11542 | Maculosin | Inquiry |
|
| MDP-23617 | Depsidomycin | Inquiry |
|
| MDP-11435 | SF2312 | Inquiry |
|
| MDP-11778 | Tristearin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
