Glucopiericidin B | CAS No. | 108073-61-6 |
| Molecular Weight | 577.71 |
| Formula | C31H47NO9 |
| SMILES | OCC1OC(C(C(C1O)O)O)OC2=C(C)C(C/C=C(C/C=C/C(C)=C/C(C(/C(C)=C/C)O)C)\C)=NC(OC)=C2OC |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23917 | Cyclothialidine D | Inquiry |
|
| MDP-23451 | Bactobolin B | Inquiry |
|
| MDP-23791 | Nothramicin | Inquiry |
|
| MDP-12101 | γ-Decalactone | Inquiry |
|
| MDP-11382 | O-Phospho-L-serine | Inquiry |
|
| MDP-12695 | Resistomycin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
