α-Glucosidase-IN-37 | CAS | 917078-12-7 |
| Molecular Weight | 262.39 |
| Formula | C17H26O2 |
| SMILES | C[C@@]12[C@](CCC([C@@H]2/C=C/C(O)=O)=C)([H])C(C)(CCC1)C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13706 | Dibenzoylmethane | Inquiry |
|
| PDP-17052 | Yuanhuadin | Inquiry |
|
| PDP-16712 | Cepharanone B | Inquiry |
|
| PDP-15998 | cis-Mulberroside A | Inquiry |
|
| PDP-15116 | Columbin | Inquiry |
|
| PDP-19212 | Polyphyllin F | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
