α-Glucosidase-IN-54 | CAS | 174284-54-9 |
| Molecular Weight | 372.54 |
| Formula | C24H36O3 |
| SMILES | CCCC/C=C\C/C=C\CCCCCCCCC1=C(C(O)=CC=C1)C(O)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13868 | beta-Mangostin | Inquiry |
|
| PDP-14609 | Mitraphylline | Inquiry |
|
| PDP-16015 | Kumujian A | Inquiry |
|
| PDP-16072 | Acanthoside B | Inquiry |
|
| PDP-12956 | Saw Palmetto Fruit Extract | Inquiry |
|
| PDP-20451 | Esculin (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
