Glucovanillin | Appearance | Solid |
| CAS | 494-08-6 |
| Purity | 99.87% |
| Molecular Weight | 314.29 |
| Formula | C14H18O8 |
| Color | White to light yellow |
| SMILES | O[C@H]1[C@H](O)[C@@H](O)[C@H](OC2=CC=C(C=O)C=C2OC)O[C@@H]1CO |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16895 | Typhatifolin B | Inquiry |
|
| PDP-15100 | Soyasapogenol A | Inquiry |
|
| PDP-16165 | Hamaudol | Inquiry |
|
| PDP-18887 | Rubicordifolin | Inquiry |
|
| PDP-16588 | Purpurogallin Carboxylic Acid | Inquiry |
|
| PDP-16777 | ω-Pentadecalactone | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
