Gomisin O | Appearance | Solid |
| CAS | 72960-22-6 |
| Purity | 99.25% |
| Molecular Weight | 416.46 |
| Formula | C23H28O7 |
| Color | Off-white to light yellow |
| SMILES | O[C@H]([C@@H](C)[C@@H](C)C1)C2=CC(OC)=C(OC)C(OC)=C2C3=C1C=C4OCOC4=C3OC |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, sealed storage, away from moisture and light In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture and light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18895 | Frangulin A | Inquiry |
|
| PDP-17008 | Dehydromiltirone | Inquiry |
|
| PDP-19943 | Pinosylvin Monomethyl Ether (Standard) | Inquiry |
|
| PDP-17440 | Vanicoside E | Inquiry |
|
| PDP-17534 | 3'-Omethyl-5'-hydroxydiplacone | Inquiry |
|
| PDP-16002 | Anemarsaponin E | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
