Gomisin S | CAS | 119239-49-5 |
| Molecular Weight | 418.48 |
| Formula | C23H30O7 |
| SMILES | COC1=C(C(O)=CC(C[C@@H]([C@@H]2C)C)=C1C3=C(C(OC)=C(C=C3[C@H]2O)OC)OC)OC |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16167 | Luteolin 7-sulfate | Inquiry |
|
| PDP-19490 | Makisterone B | Inquiry |
|
| PDP-15779 | 10-Deacetylbaccatin III (Standard) | Inquiry |
|
| PDP-13493 | Podofilox | Inquiry |
|
| PDP-16620 | Glycozolidal | Inquiry |
|
| PDP-14469 | Chelidonic Acid | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
