Gondoic Acid | Synonyms | cis-11-Eicosenoic Acid |
| Appearance | Liquid (Density: 0.883 g/cm3) |
| CAS | 5561-99-9 |
| Molecular Weight | 310.51 |
| Formula | C20H38O2 |
| Color | Colorless to light yellow |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCC(O)=O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Pure form -20°C 3 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16344 | Gomisin M1 | Inquiry |
|
| PDP-16596 | Tenacissoside B | Inquiry |
|
| PDP-16826 | 19,20-(E)-Vallesamine | Inquiry |
|
| PDP-19464 | Scillascillin | Inquiry |
|
| PDP-20073 | α-Glucosidase-IN-70 | Inquiry |
|
| PDP-17336 | (2S)-4'-Hydroxy-7-methoxyflavan | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
