Goshonoside F5 | CAS | 90851-28-8 |
| Molecular Weight | 646.76 |
| Formula | C32H54O13 |
| SMILES | O[C@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)[C@@H]1OC/C=C(C)/CC[C@@H]2C(CC[C@]3([H])[C@@](C)(CO[C@H]4[C@@H]([C@H]([C@@H]([C@@H](CO)O4)O)O)O)[C@H](O)CC[C@@]23C)=C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20504 | 8-Gingerol (Standard) | Inquiry |
|
| PDP-17939 | 1β-Hydroxy-2-oxopomolic Acid | Inquiry |
|
| PDP-13985 | Ajmaline | Inquiry |
|
| PDP-14571 | Cannflavin B | Inquiry |
|
| PDP-17613 | Kouitchenside G | Inquiry |
|
| PDP-17765 | Asparanin A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
