Grahamimycin B | CAS No. | 883434-90-0 |
| Molecular Weight | 300.30 |
| Formula | C14H20O7 |
| SMILES | O[C@H]1C(C[C@H](C(O[C@@H](C/C=C/C(O[C@H](C1)C)=O)C)=O)O)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11726 | Disodium 5'-inosinate | Inquiry |
|
| MDP-23048 | 3,2'-Dihydroxy-4,4'-dimethoxychalcone | Inquiry |
|
| MDP-23958 | Menoxymycin A | Inquiry |
|
| MDP-23971 | Salfredin A3 | Inquiry |
|
| MDP-11023 | Fluconazole | Inquiry |
|
| MDP-12610 | Rostratin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
