Gymnestrogenin | Appearance | Solid |
| CAS | 19942-02-0 |
| Purity | 99.32% |
| Molecular Weight | 490.72 |
| Formula | C30H50O5 |
| Color | White to off-white |
| SMILES | OC[C@]1(C[C@H](O)C(C)(C)C2)[C@]2([H])C3=CC[C@@]4([H])[C@@](C)(CC[C@]5([H])[C@@]4(CC[C@H](O)[C@@]5(C)CO)C)[C@]3(C)C[C@@H]1O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16963 | Eupatarone | Inquiry |
|
| PDP-15560 | Lappaol A | Inquiry |
|
| PDP-18848 | Bletilol B | Inquiry |
|
| PDP-15058 | Emodin 6-O-β-D-glucoside | Inquiry |
|
| PDP-13863 | N-trans-Feruloyltyramine | Inquiry |
|
| PDP-12959 | Pygeum Extract | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
