Gyrophoric Acid | CAS No. | 548-89-0 |
| Purity | ≥98.0% |
| Molecular Weight | 468.41 |
| Formula | C24H20O10 |
| Appearance | Solid |
| Color | White to off-white |
| SMILES | O=C(OC1=CC(C)=C(C(O)=O)C(O)=C1)C2=C(C)C=C(OC(C3=C(C)C=C(O)C=C3O)=O)C=C2O |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22491 | O-Desmethylangolensin (Standard) | Inquiry |
|
| MDP-23640 | Dihydromevinolin | Inquiry |
|
| MDP-11581 | Cladosporin | Inquiry |
|
| MDP-22126 | 3-Oxo-resibufogenin | Inquiry |
|
| MDP-23459 | Arisostatin B | Inquiry |
|
| MDP-22000 | 2,3-Dihydrocalodenin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
