Hedysarimcoumestan B | CAS | 899436-04-5 |
| Molecular Weight | 298.25 |
| Formula | C16H10O6 |
| SMILES | O=C1OC2=CC(O)=CC(O)=C2C3=C1C4=C(O3)C=C(OC)C=C4 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18417 | Isobonducellin | Inquiry |
|
| PDP-13454 | Diallyl Trisulfide | Inquiry |
|
| PDP-14233 | Luteolin-3-O-beta-D-glucuronide | Inquiry |
|
| PDP-17829 | 5-Dexyexcoecafolin B | Inquiry |
|
| PDP-13874 | L-Chicoric Acid | Inquiry |
|
| PDP-13803 | Theaflavin-3-gallate | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
