Hesperetin | CAS No. | 520-33-2 |
| Purity | 98.98% |
| Molecular Weight | 302.28 |
| Formula | C16H14O6 |
| Appearance | Solid |
| Color | Light yellow to yellow |
| SMILES | O=C1C[C@@H](C2=CC=C(OC)C(O)=C2)OC3=CC(O)=CC(O)=C13 |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11172 | Inosinic Acid | Inquiry |
|
| MDP-23795 | Madindoline B | Inquiry |
|
| MDP-24289 | Helvecardin B | Inquiry |
|
| MDP-23990 | Cymbimicin B | Inquiry |
|
| MDP-23868 | Kistamicin B | Inquiry |
|
| MDP-11182 | Fumonisin B1 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
