Heteroclitin D | Appearance | Solid |
| CAS | 140369-76-2 |
| Purity | 99.91% |
| Molecular Weight | 482.52 |
| Formula | C27H30O8 |
| Color | Off-white to light yellow |
| SMILES | O=C(C(OC)=C(OC)C=C1CC(C)C2C)C1(COC3=C(OCO4)C4=C5)C3=C5C2OC(/C(C)=C/C)=O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19085 | 3",4"-Di-O-acetyl-2",6"-di-O-p-coumaroylastragalin | Inquiry |
|
| PDP-19180 | Violanone | Inquiry |
|
| PDP-15042 | 7,3',4'-Tri-O-methylluteolin | Inquiry |
|
| PDP-19449 | Walsuronoid B | Inquiry |
|
| PDP-13047 | Schisandra Extract | Inquiry |
|
| PDP-16592 | D-Mannopyranose | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
