Hexamethylquercetagetin | Synonyms | Hexa-O-methylquercetagetin; Quercetagetin Hexamethyl Ether; 3,5,6,7,3',4'-Hexamethoxyflavone |
| CAS | 1251-84-9 |
| Molecular Weight | 402.39 |
| Formula | C21H22O8 |
| SMILES | O=C1C(OC)=C(C2=CC=C(OC)C(OC)=C2)OC3=CC(OC)=C(OC)C(OC)=C13 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13590 | Anabasine | Inquiry |
|
| PDP-16148 | Feretoside | Inquiry |
|
| PDP-18528 | Nudicaucin B | Inquiry |
|
| PDP-19406 | 3β-Hydroxyurs-11-en-28,13β-olide | Inquiry |
|
| PDP-13136 | Rutin | Inquiry |
|
| PDP-13844 | Dracorhodin Perchlorate | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
