Hispidanin B | CAS | 1616080-84-2 |
| Molecular Weight | 656.89 |
| Formula | C42H56O6 |
| SMILES | OC([C@]1([C@@](C(C)(CCC1)C)([H])CCC2=C)[C@@]2([H])C[C@@H]3[C@@]4(CCC=C3C)C5=C(OC4=O)C=CC6=C5[C@@H](OC(C)=O)C[C@](C(C)(CCC7)C)([H])[C@@]67C)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20020 | Tuberostemonine D | Inquiry |
|
| PDP-18667 | Epi-galantamine | Inquiry |
|
| PDP-19851 | (E)-3',6-Disinapoylsucrose (Standard) | Inquiry |
|
| PDP-15257 | Nodakenetin | Inquiry |
|
| PDP-15465 | 5-Hydroxyoxindole | Inquiry |
|
| PDP-20334 | Platycodin D (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
