Homoplantaginin (Standard) | CAS | 17680-84-1 |
| Molecular Weight | 462.40 |
| Formula | C22H22O11 |
| SMILES | OC1=C(C2=O)C(OC(C3=CC=C(O)C=C3)=C2)=CC(O[C@@H]([C@@H]([C@@H](O)[C@@H]4O)O)O[C@@H]4CO)=C1OC |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18077 | Bis-5,5-Nortrachelogenin | Inquiry |
|
| PDP-19309 | Hosenkoside F | Inquiry |
|
| PDP-16235 | Regaloside H | Inquiry |
|
| PDP-14225 | Dehydroandrographolide | Inquiry |
|
| PDP-19672 | Pinosylvin (Standard) | Inquiry |
|
| PDP-17829 | 5-Dexyexcoecafolin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
