Homovanillic Acid | CAS No. | 306-08-1 |
| Purity | 99.96% |
| Synonyms | Vanilacetic Acid |
| Molecular Weight | 182.18 |
| Formula | C9H10O4 |
| Appearance | Solid |
| Color | White to light brown |
| SMILES | O=C(O)CC1=CC=C(O)C(OC)=C1 |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
4°C, protect from light, stored under nitrogen In solvent: -80°C, 6 months; -20°C, 1 month (protect from light, stored under nitrogen) |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-10929 | Nicotinamide | Inquiry |
|
| MDP-23934 | Kirrothricin | Inquiry |
|
| MDP-23957 | Fluoropolyoxin M | Inquiry |
|
| MDP-24244 | Pradimicin B | Inquiry |
|
| MDP-23048 | 3,2'-Dihydroxy-4,4'-dimethoxychalcone | Inquiry |
|
| MDP-10966 | L-Glutamic Acid | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
